BD0037156
Benzyl2-amino-2-methylpropanoatehydrochloride , 98% , 60421-20-7
Synonym(s):
2-Methylalanine benzyl ester hydrochloride;Benzyl 2-amino-2-methylpropionate hydrochloride;H-Aib-OBzl
CAS NO.：60421-20-7
Empirical Formula: C11H16ClNO2
Molecular Weight: 229.703
MDL number: MFCD14155677
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB141.60 | In Stock |
|
| 25g | RMB514.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-171℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble50mg/mL, clear, colorless |
| form | powder |
| Appearance | White to off-white Solid |
| Water Solubility | H2O: 50mg/mL, clear, colorless |
| BRN | 5149947 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H15NO2.ClH/c1-11(2,12)10(13)14-8-9-6-4-3-5-7-9;/h3-7H,8,12H2,1-2H3;1H |
| InChIKey | OXUUEIDXKLFLER-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)C(N)(C)C.[H]Cl |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |