PRODUCT Properties
| Melting point: | 302-307 °C |
| Boiling point: | 443.7±18.0 °C(Predicted) |
| Density | 1.506±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.01±0.30(Predicted) |
| form | Crystalline Powder |
| color | White to light brown |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)5-1-2-6-4-9-10-7(6)3-5/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | DNCVTVVLMRHJCJ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(O)=O)=C2)C=N1 |
Description and Uses
1H-Indazole-6-carboxylic Acid is used as a reagent to synthesize azabicyclic aryl amides, which act as α7 nicotinic acetylcholine receptor agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339980 |







