BD0047456
1,3-Dimethyl-6-nitro-1H-indazole , 98% , 1354224-47-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB259.20 | In Stock |
|
| 1g | RMB673.60 | In Stock |
|
| 5g | RMB2356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 346.8±22.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -0.18±0.50(Predicted) |
| Appearance | Light yellow to yellow Solid |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C9H9N3O2/c1-6-8-4-3-7(12(13)14)5-9(8)11(2)10-6/h3-5H,1-2H3 |
| InChIKey | RUTULKJFQZYUDG-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC([N+]([O-])=O)=C2)C(C)=N1 |
Description and Uses
1,3-dimethyl-6-nitro-1H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







