BD0052132
Ethyl oxazole-5-carboxylate , 97% , 118994-89-1
Synonym(s):
5-Oxazolecarboxylic acid ethyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB144.80 | In Stock |
|
| 10g | RMB257.60 | In Stock |
|
| 25g | RMB600.00 | In Stock |
|
| 100g | RMB1968.80 | In Stock |
|
| 500g | RMB8870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 202.0±13.0℃ (760 Torr) |
| Density | 1.163 g/mL at 25 °C |
| refractive index | n20/D 1.468 |
| Flash point: | 79°C |
| storage temp. | 2-8°C |
| pka | -1.08±0.10(Predicted) |
| form | liquid |
| color | Colourless |
| Water Solubility | Soluble in water (35 g/L at 25°C). |
| InChI | InChI=1S/C6H7NO3/c1-2-9-6(8)5-3-7-4-10-5/h3-4H,2H2,1H3 |
| InChIKey | KRMORCCAHXFIHF-UHFFFAOYSA-N |
| SMILES | O1C(C(OCC)=O)=CN=C1 |
Description and Uses
Ethyl Oxazole-5-carboxylate belongs to the carboxylic ester group of organic compounds,and it is a useful research chemical.
Ethyl oxazole-5-carboxylate is used as a pharmaceutical, organic intermediate and in organic light-emitting diode.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | CBL |
| HS Code | 2934999090 |
| Excepted Quantities | Non-Hazardous |
