BD0053832
Imidazo[1,2-a]pyridine-6-boronic acid , 97% , 913835-63-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB218.40 | In Stock |
|
| 250mg | RMB396.80 | In Stock |
|
| 1g | RMB828.80 | In Stock |
|
| 5g | RMB2750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | powder |
| pka | 7.99±0.43(Predicted) |
| color | Pale Cream |
| InChI | InChI=1S/C7H7BN2O2/c11-8(12)6-1-2-7-9-3-4-10(7)5-6/h1-5,11-12H |
| InChIKey | IPJIKGJKMCILGV-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C=CN=C2C=C1)(O)O |
| CAS DataBase Reference | 913835-63-9 |
Description and Uses
Imidazo[1,2-a]pyridine-6-boronic acid is a useful intermediate for organic synthesis and other pharmaceutical processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2934100090 |

![Imidazo[1,2-a]pyridine-6-boronic acid](https://img.chemicalbook.com/CAS/GIF/913835-63-9.gif)

![Imidazo[1,5-a]pyridine-1-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/56671-67-1.gif)
![6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine](https://img.chemicalbook.com/CAS/20150408/GIF/1204742-76-6.gif)


