BD0055756
Benzimidamide , 95% , 618-39-3
CAS NO.：618-39-3
Empirical Formula: C7H8N2
Molecular Weight: 120.15
MDL number: MFCD00042826
EINECS: 210-546-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB137.60 | In Stock |
|
| 5g | RMB414.40 | In Stock |
|
| 10g | RMB690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-70 °C |
| Boiling point: | 208.5±23.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.90±0.40(Predicted) |
| form | powder or crystals |
| color | White to Off-White |
| BRN | 606020 |
| InChI | InChI=1S/C7H8N2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H3,8,9) |
| InChIKey | PXXJHWLDUBFPOL-UHFFFAOYSA-N |
| SMILES | C1(C(N)=N)=CC=CC=C1 |
Description and Uses
Benzamidine was used in the preparation of heparan sulfate-rich proteoglycan from mouse mammary epithelial cells. It has been used to prevent enzymatic degradation during the purification procedure of bovine factor XII (Hageman factor).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 9-23 |
| HS Code | 29299000 |
| Storage Class | 11 - Combustible Solids |
