![tert-Butyl 2,4-dichloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate](https://img.chemicalbook.com/CAS/GIF/916420-27-4.gif)
BD0062532
tert-Butyl 2,4-dichloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate , 97% , 916420-27-4
CAS NO.：916420-27-4
Empirical Formula: C12H15Cl2N3O2
Molecular Weight: 304.17
MDL number: MFCD09025732
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB26.40 | In Stock |
|
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB93.60 | In Stock |
|
| 5g | RMB344.80 | In Stock |
|
| 10g | RMB665.60 | In Stock |
|
| 25g | RMB1580.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 423.1±45.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -1.95±0.20(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C12H15Cl2N3O2/c1-12(2,3)19-11(18)17-5-4-7-8(6-17)15-10(14)16-9(7)13/h4-6H2,1-3H3 |
| InChIKey | SAEOMPAQDWZLHC-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C2CCN(C(OC(C)(C)C)=O)CC2=N1 |
Description and Uses
tert-Butyl 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate (tert-Butyl 2,4-dichloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate) can be used as an intermediate for laboratory R&D.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P305+P351+P338 |
| HS Code | 2933998090 |
![2,4-Dibromobenzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/887589-19-7.gif)
