BD0079348
Trimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane , 98+% , 134695-74-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB195.20 | In Stock |
|
| 1g | RMB487.20 | In Stock |
|
| 5g | RMB1704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 45°C 0,03mm |
| Density | 0,852 g/cm3 |
| refractive index | 1.4860 |
| Flash point: | 73°C |
| storage temp. | Sealed in dry,Room Temperature |
| Specific Gravity | 0.852 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C12H22Si/c1-8-9(2)11(4)12(10(8)3)13(5,6)7/h12H,1-7H3 |
| InChIKey | VEUUNIUMKJTBJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(C)=C(C)C1[Si](C)(C)C |
Description and Uses
Trimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane may be used for the synthesis of aryl/heteroarylpiperazine derivatives.
Safety
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 10 - Combustible liquids |





