BD0086432
Quinoxaline-6-carbaldehyde , 97% , 130345-50-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB64.00 | In Stock |
|
| 250mg | RMB156.00 | In Stock |
|
| 1g | RMB417.60 | In Stock |
|
| 5g | RMB1422.40 | In Stock |
|
| 10g | RMB2695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-131 °C |
| Boiling point: | 319.8±22.0 °C(Predicted) |
| Density | 1.299±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.24±0.30(Predicted) |
| form | solid |
| color | Pale brown |
| InChI | InChI=1S/C9H6N2O/c12-6-7-1-2-8-9(5-7)11-4-3-10-8/h1-6H |
| InChIKey | UGOIXUFOAODGNI-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C=O)=CC=2)N=CC=1 |
| CAS DataBase Reference | 130345-50-5(CAS DataBase Reference) |
Description and Uses
Quinoxaline-6-carbaldehyde can be used as raw material or intermediate of organic synthesis. It is used in the synthesis of 6-(bromomethyl)quinoxaline and ligands for targeting RNA.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
