BD0089832
Methyl 2-aminothiazole-5-carboxylate , 95% , 6633-61-0
CAS NO.：6633-61-0
Empirical Formula: C5H6N2O2S
Molecular Weight: 158.18
MDL number: MFCD03788562
EINECS: 640-111-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB71.20 | In Stock |
|
| 10g | RMB114.40 | In Stock |
|
| 25g | RMB224.00 | In Stock |
|
| 100g | RMB834.40 | In Stock |
|
| 500g | RMB2955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-186°C |
| Boiling point: | 298.7±13.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.02±0.10(Predicted) |
| form | Solid |
| color | Tan to Light Brown |
| InChI | InChI=1S/C5H6N2O2S/c1-9-4(8)3-2-7-5(6)10-3/h2H,1H3,(H2,6,7) |
| InChIKey | UJNNCGWBDJHCEM-UHFFFAOYSA-N |
| SMILES | S1C(C(OC)=O)=CN=C1N |
| CAS DataBase Reference | 6633-61-0(CAS DataBase Reference) |
Description and Uses
Methyl 2-Aminothiazole-5-carboxylate (cas# 6633-61-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Harmful |
| HS Code | 29349990 |
