BD0098832
Pyrazolo[1,5-a]pyridine-3-carboxylic acid , 95% , 16205-46-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB70.40 | In Stock |
|
| 250mg | RMB121.60 | In Stock |
|
| 1g | RMB251.20 | In Stock |
|
| 5g | RMB889.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199 °C |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -0.61±0.41(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h1-5H,(H,11,12) |
| InChIKey | HRSDPDBQVZHCRC-UHFFFAOYSA-N |
| SMILES | C12=C(C(O)=O)C=NN1C=CC=C2 |
Description and Uses
Pyrazolo[1,5-a]pyridine-3-carboxylic acid is a useful intermediate for the improved synthesis of pyrazolo[1,5-a]pyridine-3-carboxylic acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| HS Code | 29333990 |

![Pyrazolo[1,5-a]pyridine-3-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/16205-46-2.gif)

![Pyrazolo[1,5-a]pyridine-2,3-dicarboxylicacid](https://img.chemicalbook.com/CAS/GIF/63237-87-6.gif)

![ethyl pyrazolo[1,5-a]pyridine-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/16205-44-0.gif)
![Pyrazolo[1,5-a]pyridine-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/63237-88-7.gif)
![Pyrazolo[1,5-a]pyridin-3-amine](https://img.chemicalbook.com/CAS/GIF/137837-55-9.gif)