BD0102232
(5-Methylthiophen-2-yl)boronic acid , 95% , 162607-20-7
Synonym(s):
(5-Methylthien-2-yl)boronic acid;(5-Methylthiophen-2-yl)dihydroxyborane;2-Methylthienyl-5-boronic acid;2-Methylthiophene-5-boronic acid;5-Methyl-2-thiopheneboronic acid
CAS NO.:162607-20-7
Empirical Formula: C5H7BO2S
Molecular Weight: 141.98
MDL number: MFCD01318166
EINECS: 672-308-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB182.40 | In Stock |
|
| 10g | RMB290.40 | In Stock |
|
| 25g | RMB618.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161.5-166.5 °C(lit.) |
| Boiling point: | 302.9±44.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.73±0.53(Predicted) |
| color | White to Yellow to Orange |
| BRN | 7019569 |
| InChI | InChI=1S/C5H7BO2S/c1-4-2-3-5(9-4)6(7)8/h2-3,7-8H,1H3 |
| InChIKey | NRIYPIBRPGAWDD-UHFFFAOYSA-N |
| SMILES | B(C1SC(C)=CC=1)(O)O |
| CAS DataBase Reference | 162607-20-7(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Suzuki-Miyaura cross-coupling reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-7/9-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






