BD0118832
4-Boc-3-Morpholinecarboxylic acid , 95% , 212650-43-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.00 | In Stock |
|
| 1g | RMB117.60 | In Stock |
|
| 5g | RMB518.40 | In Stock |
|
| 10g | RMB998.40 | In Stock |
|
| 25g | RMB2376.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 369℃ |
| Density | 1.230 |
| Flash point: | 177℃ |
| storage temp. | 2-8°C |
| pka | 3.53±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-9(14)11-4-5-15-6-7(11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | KVXXEKIGMOEPSA-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCOCC1C(O)=O |
| CAS DataBase Reference | 212650-43-6(CAS DataBase Reference) |
Description and Uses
Morpholine-3,4-dicarboxylic acid 4-tert-butyl ester is an organic heterocyclic compound that can be used in decarboxylation arylation reactions to prepare other compounds. It is also used as a synthetic intermediate component in the preparation of substances such as thienopyrrole compounds, pyridine derivatives and cyclised acetamide derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-51-36 |
| Safety Statements | 26-36/37/39 |
