BD0120053
7-Fluoroisatin , 97% , 317-20-4
Synonym(s):
7-Fluoroindole-1H-2,3-dione
CAS NO.：317-20-4
Empirical Formula: C8H4FNO2
Molecular Weight: 165.12
MDL number: MFCD01569508
EINECS: 626-799-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB98.40 | In Stock |
|
| 25g | RMB428.80 | In Stock |
|
| 100g | RMB1568.00 | In Stock |
|
| 500g | RMB7182.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-196°C |
| Density | 1.477±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | Dimethylformamide[soluble in] |
| form | powder to crystal |
| pka | 8.44±0.20(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Sparingly Soluble in water (0.022 g/L) |
| InChI | InChI=1S/C8H4FNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12) |
| InChIKey | HGBGVEOXPHGSOS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2F)C(=O)C1=O |
| CAS DataBase Reference | 317-20-4(CAS DataBase Reference) |
Description and Uses
7-Fluoroisatin is used as the intermediate of cardiovascular, anti-inflammatory and bactericidal drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43 |
| Safety Statements | 37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
