BD0120253
                    4-Ethyl-1,3-dioxolan-2-one , 98% , 4437-85-8
CAS NO.:4437-85-8
Empirical Formula: C5H8O3
Molecular Weight: 116.12
MDL number: MFCD00143317
EINECS: 403-780-4
| Pack Size | Price | Stock | Quantity | 
| 5g | RMB66.40 | In Stock | 
                                                 | 
                                        
| 25g | RMB249.60 | In Stock | 
                                                 | 
                                        
| 100g | RMB861.60 | In Stock | 
                                                 | 
                                        
| 500g | RMB3360.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | -45 °C | 
                                    
| Boiling point: | 251 °C | 
                                    
| Density | 1.141 | 
                                    
| refractive index | 1.426-1.428 | 
                                    
| Flash point: | 135 °C | 
                                    
| storage temp. | Store at room temperature | 
                                    
| Appearance | Colorless to light yellow Liquid | 
                                    
| InChI | InChI=1S/C5H8O3/c1-2-4-3-7-5(6)8-4/h4H,2-3H2,1H3 | 
                                    
| InChIKey | ZZXUZKXVROWEIF-UHFFFAOYSA-N | 
                                    
| SMILES | O1CC(CC)OC1=O | 
                                    
| LogP | 0.099 (est) | 
                                    
| CAS DataBase Reference | 4437-85-8 | 
                                    
| EPA Substance Registry System | 1,3-Dioxolan-2-one, 4-ethyl- (4437-85-8) | 
                                    
Description and Uses
1,2-Butylene Carbonate is used in planarizing process and composition.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H319 | 
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P | 
| Safety Statements | 24/25 | 
| RIDADR | 1993 | 
| RTECS | JI4582000 | 
| HazardClass | 3.2 | 
| PackingGroup | III | 
| HS Code | 29209010 | 







