BD0128153
trans-4-(Trifluoromethyl)cyclohexanamine , 98% , 1073266-02-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB193.60 | In Stock |
|
| 250mg | RMB264.80 | In Stock |
|
| 1g | RMB723.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 145.1±35.0 °C(Predicted) |
| Density | 1.136±0.06 g/cm3(Predicted) |
| refractive index | 1.4040 to 1.4080 |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 10.29±0.70(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C7H12F3N/c8-7(9,10)5-1-3-6(11)4-2-5/h5-6H,1-4,11H2/t5-,6- |
| InChIKey | YCBWLMWEQURJHX-IZLXSQMJSA-N |
| SMILES | [C@@H]1(N)CC[C@@H](C(F)(F)F)CC1 |
| CAS DataBase Reference | 1073266-02-0 |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| RIDADR | UN 2734 8/3/PG II |
| HS Code | 2921.30.3000 |
| HazardClass | 8/3 |
| PackingGroup | II |




