BD0134132
2-Aminobenzothiazol-6-ol , 97% , 26278-79-5
Synonym(s):
2-Amino-6-benzothiazolol;2-Amino-6-hydroxybenzothiazole;6-Hydroxy-2-aminobenzothiazole;6-Hydroxybenzothiazol-2-amine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB157.60 | In Stock |
|
| 10g | RMB278.40 | In Stock |
|
| 25g | RMB587.20 | In Stock |
|
| 100g | RMB2196.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-250℃ |
| Boiling point: | 394.6±34.0 °C(Predicted) |
| Density | 1.553±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 8.69±0.40(Predicted) |
| Appearance | Off-white to gray Solid |
| InChI | InChI=1S/C7H6N2OS/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,10H,(H2,8,9) |
| InChIKey | VLNVTNUTGNBNBY-UHFFFAOYSA-N |
| SMILES | S1C2=CC(O)=CC=C2N=C1N |
| CAS DataBase Reference | 26278-79-5(CAS DataBase Reference) |
Description and Uses
2-Amino-6-hydroxybenzothiazole is a reagent used in the chemical synthesis of new benzothiazole derivatives with anti proliferative and antiiconvulsant activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H319 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-36-20/21/22-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934208090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 |






