BD0135432
tert-Butyl 3-(aminomethyl)pyrrolidine-1-carboxylate , 97% , 270912-72-6
Synonym(s):
tert-Butyl 3-(aminomethyl)pyrrolidine-1-carboxylate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB136.80 | In Stock |
|
| 5g | RMB593.60 | In Stock |
|
| 10g | RMB1050.40 | In Stock |
|
| 25g | RMB2296.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-210°C |
| Boiling point: | 280.3±13.0 °C(Predicted) |
| Density | 1.044±0.06 g/cm3(Predicted) |
| refractive index | 1.4740 |
| storage temp. | 2-8°C |
| form | solid |
| pka | 10.12±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | 0.11°(C=1g/100ml CHCL3) |
| Sensitive | Air Sensitive |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-7,11H2,1-3H3 |
| InChIKey | OGCCBDIYOAFOGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN)C1 |
| CAS DataBase Reference | 270912-72-6(CAS DataBase Reference) |
Description and Uses
tert-butyl 3-(aminomethyl)pyrrolidine-1-carboxylate is a useful intermediate for organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H400 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 36/37/38-50-36-22 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |




