BD0163832
2-Chloropyrimidine-5-carboxylic acid , 97% , 374068-01-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB22.40 | In Stock |
|
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB216.00 | In Stock |
|
| 10g | RMB412.00 | In Stock |
|
| 25g | RMB850.40 | In Stock |
|
| 100g | RMB3184.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-131 °C |
| Boiling point: | 411.4±18.0 °C(Predicted) |
| Density | 1.579±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder or Crystalline Powder |
| pka | 2.51±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C5H3ClN2O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10) |
| InChIKey | DUCXUPKLVVSJKA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(O)=O)C=N1 |
Description and Uses
2-Chloropyrimidine-5-carboxylic Acid is a compound involved in the synthesis of novel (6-aminopyridin-3-yl)(4-(pyridin-2-yl)piperazin-1-yl) methanone derivatives as TRPV4 antagonists for the treatment of pain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





