BD0180953
(3R,4R)-2,5-Dioxotetrahydrofuran-3,4-diyldiacetate , 97% , 6283-74-5
Synonym(s):
(+)-Diacetyl-L -tartaric anhydride
CAS NO.：6283-74-5
Empirical Formula: C8H8O7
Molecular Weight: 216.14
MDL number: MFCD00037918
EINECS: 228-502-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB46.40 | In Stock |
|
| 25g | RMB134.40 | In Stock |
|
| 100g | RMB470.40 | In Stock |
|
| 250g | RMB960.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-135 °C(lit.) |
| Boiling point: | 316.55°C (rough estimate) |
| Density | 1.5197 (rough estimate) |
| refractive index | 90 ° (C=0.5, CHCl3) |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform (Slightly, Heated) |
| form | Crystals or Needles |
| color | White |
| optical activity | [α]20/D +59°, c = 6 in acetone |
| Water Solubility | Soluble in methanol and dichloromethane. Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 87315 |
| InChI | 1S/C8H8O7/c1-3(9)13-5-6(14-4(2)10)8(12)15-7(5)11/h5-6H,1-2H3/t5-,6-/m1/s1 |
| InChIKey | XAKITKDHDMPGPW-PHDIDXHHSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)C(=O)OC1=O |
| CAS DataBase Reference | 6283-74-5(CAS DataBase Reference) |
Description and Uses
Di-O-acetyl-L-tartaric Anhydride (cas# 6283-74-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
