BD0199953
Calciumdihydrogenphoshate , AR , 7758-23-8
Synonym(s):
Calcium bis(dihydrogen phosphate);Calcium dihydrogen phosphate
CAS NO.:7758-23-8
Empirical Formula: CaH4O8P2
Molecular Weight: 234.05
MDL number: MFCD00010898
EINECS: 231-837-1
| Pack Size | Price | Stock | Quantity |
| 100g | RMB24.00 | In Stock |
|
| 500g | RMB31.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109 °C |
| Boiling point: | 203 °C (decomposes) |
| Density | 2.22(16/4℃) |
| refractive index | 1.5176 |
| form | Crystals |
| Odor | Odorless |
| Water Solubility | insoluble |
| Merck | 13,1698 |
| Stability: | Stable. Incompatible with strong acids. |
| InChI | InChI=1S/Ca.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| SMILES | P(=O)(O)(O)[O-].P([O-])(=O)(O)O.[Ca+2] |
| LogP | -2.148 (est) |
| CAS DataBase Reference | 7758-23-8(CAS DataBase Reference) |
| EPA Substance Registry System | Monocalcium phosphate (7758-23-8) |
Description and Uses
Chiefly in fertilizers; as acidulant in baking powders and in wheat flours; mineral supplement for foods and feeds; in enameling.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Signal word | Danger |
| Hazard statements | H318 |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/37-37/39-39 |
| WGK Germany | 2 |
| RTECS | TB8527000 |
| HS Code | 31031010 |
| Hazardous Substances Data | 7758-23-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 3986mg/kg |




