BD0211653
2,2,7,7-Tetramethyl-4-((trimethylsilyl)oxy)-3,6-dioxa-2,7-disilaoct-4-ene , 97% , 69097-20-7
CAS NO.:69097-20-7
Empirical Formula: C11H28O3Si3
Molecular Weight: 292.59
MDL number: MFCD00011641
EINECS: 273-864-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB63.20 | In Stock |
|
| 1g | RMB148.00 | In Stock |
|
| 5g | RMB501.60 | In Stock |
|
| 25g | RMB1707.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 54-56 °C/0.1 mmHg (lit.) |
| Density | 0.886 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 103 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| Specific Gravity | 0.885 |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1962905 |
| InChI | InChI=1S/C11H28O3Si3/c1-15(2,3)12-10-11(13-16(4,5)6)14-17(7,8)9/h10H,1-9H3 |
| InChIKey | FCZGHPGTZRTDNN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O/C(/O[Si](C)(C)C)=C/O[Si](C)(C)C |
| CAS DataBase Reference | 69097-20-7(CAS DataBase Reference) |
Description and Uses
Tris(trimethylsiloxy)ethylene has been used in:
- stereospecific synthesis of insecticide ajuqarin-IV
- microwave-assisted synthesis of 2-hydroxy-1-phenylethanone
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







