![3-([1,1'-Biphenyl]-4-yl)-5-(4-(tert-butyl)phenyl)-4-phenyl-4H-1,2,4-triazole](https://img.chemicalbook.com/CAS/GIF/150405-69-9.gif)
BD0211848
3-([1,1'-Biphenyl]-4-yl)-5-(4-(tert-butyl)phenyl)-4-phenyl-4H-1,2,4-triazole , 97% , 150405-69-9
Synonym(s):
TAZ
CAS NO.：150405-69-9
Empirical Formula: C30H27N3
Molecular Weight: 429.56
MDL number: MFCD00799419
EINECS: 623-896-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2217.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-235 °C |
| Boiling point: | 611.5±58.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| pka | 1.78±0.10(Predicted) |
| form | powder/crystals |
| color | White |
| InChI | 1S/C30H27N3/c1-30(2,3)26-20-18-25(19-21-26)29-32-31-28(33(29)27-12-8-5-9-13-27)24-16-14-23(15-17-24)22-10-6-4-7-11-22/h4-21H,1-3H3 |
| InChIKey | ZVFQEOPUXVPSLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)-c2cc(cc(c2)-c3nc[nH]n3)-c4ccc(cc4)-c5ccccc5 |
| CAS DataBase Reference | 150405-69-9 |
| Absorption | λmax 280 nmin chloroform |
Description and Uses
1,2,4-triazole-based 3-(biphenyl-4-yl)-5-(4-tertbutylphenyl)-4-phenyl-4H-1,2,4-triazole(TAZ) (ET: 2.7 eV,HOMO/LUMO: 6.3/2.7 eV) has mostly been used in blue phosphorescent OLEDs (PhOLEDs) to serve as an efficient electron-transporting and hole-blocking layer due to its high triplet energy level that would confine the triplet excitons within the emissive layer.
OLED and QD-LED electron transporter and hole blocker material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
