BD0232553
N,N,4-Trimethylbenzenesulfonamide , 97% , 599-69-9
CAS NO.:599-69-9
Empirical Formula: C9H13NO2S
Molecular Weight: 199.27
MDL number: MFCD00152452
EINECS: 209-971-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB105.60 | In Stock |
|
| 1g | RMB246.40 | In Stock |
|
| 5g | RMB716.80 | In Stock |
|
| 10g | RMB1147.20 | In Stock |
|
| 25g | RMB2296.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-153 °C |
| Boiling point: | 208°C (rough estimate) |
| Density | 1.1991 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Store at room temperature |
| pka | -4.51±0.70(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C9H13NO2S/c1-8-4-6-9(7-5-8)13(11,12)10(2)3/h4-7H,1-3H3 |
| InChIKey | WZKOKGOAHBIPCI-UHFFFAOYSA-N |
| SMILES | C1(S(N(C)C)(=O)=O)=CC=C(C)C=C1 |
| EPA Substance Registry System | Benzenesulfonamide, N,N,4-trimethyl- (599-69-9) |
Description and Uses
4-Methyl-N,N-di(methyl-13C)benzenesulfonamide is an intermediate in the synthesis of Dimethylamine Hydrochloride-13C2 (D446734), the hydrochloride salt and isotope labelled analog of Dimethylamine (D461480); a compound often used in industry as a precursor to Nitrosodimethylamine (N525625). Dimethylamine is also present in human urine and can be indicative of certain disorders.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| TSCA | TSCA listed |







