BD0265253
5,12-Bis(phenylethynyl)tetracene , 95% , 18826-29-4
CAS NO.:18826-29-4
Empirical Formula: C34H20
Molecular Weight: 428.52
MDL number: MFCD00012052
EINECS: 242-605-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB742.40 | In Stock |
|
| 250mg | RMB1113.60 | In Stock |
|
| 1g | RMB2783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248 °C (dec.)(lit.) |
| Boiling point: | 683.7±28.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| InChI | InChI=1S/C34H20/c1-3-11-25(12-4-1)19-21-31-29-17-9-10-18-30(29)32(22-20-26-13-5-2-6-14-26)34-24-28-16-8-7-15-27(28)23-33(31)34/h1-18,23-24H |
| InChIKey | OUHYGBCAEPBUNA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(C#CC3=CC=CC=C3)=C3C(=C2C#CC2=CC=CC=C2)C=C2C(C=CC=C2)=C3)=CC=C1 |
| EPA Substance Registry System | Naphthacene, 5,12-bis(phenylethynyl)- (18826-29-4) |
Description and Uses
5,12-Bis(phenylethynyl)tetracene is a benzene derivative, which can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |







