BD0291953
Methyl2,2,3,3,4,4,4-heptafluorobutanoate , 97% , 356-24-1
CAS NO.:356-24-1
Empirical Formula: C5H3F7O2
Molecular Weight: 228.06
MDL number: MFCD00000433
EINECS: 206-600-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB57.60 | In Stock |
|
| 25g | RMB132.80 | In Stock |
|
| 100g | RMB523.20 | In Stock |
|
| 500g | RMB2572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -86°C |
| Boiling point: | 80-81 °C(lit.) |
| Density | 1.472 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Slightly soluble in water |
| form | clear liquid |
| Specific Gravity | 1.472 |
| color | Colorless to Almost colorless |
| BRN | 1792131 |
| InChI | InChI=1S/C5H3F7O2/c1-14-2(13)3(6,7)4(8,9)5(10,11)12/h1H3 |
| InChIKey | MRPUVAKBXDBGJQ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 356-24-1(CAS DataBase Reference) |
| EPA Substance Registry System | Methyl heptafluorobutyrate (356-24-1) |
Description and Uses
Methyl Heptafluorobutyrate is used in method for preparing high-carbon branched secondary Alcohol, and its application in preparing surfactant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN 3272 3/PG II |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | T |
| HazardClass | IRRITANT, FLAMMABLE |
| PackingGroup | II |
| HS Code | 29159000 |







