PRODUCT Properties
| Melting point: | 152-155 °C (lit.) |
| Boiling point: | 335.48°C (rough estimate) |
| Density | 1.3764 (rough estimate) |
| refractive index | 1.6180 (estimate) |
| pka | 0.60±0.14(Predicted) |
| form | Granular Crystalline Powder |
| color | Dark khaki |
| InChI | 1S/C8H10N2O4/c1-13-7-4-6(10(11)12)8(14-2)3-5(7)9/h3-4H,9H2,1-2H3 |
| InChIKey | ZTQGTYFYOODGOQ-UHFFFAOYSA-N |
| SMILES | COc1cc(c(OC)cc1N)[N+]([O-])=O |
| CAS DataBase Reference | 6313-37-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 2,5-dimethoxy-4-nitro- (6313-37-7) |
Description and Uses
2,5-Dimethoxy-4-nitroaniline was used in screening of enzyme arylamine N-acetyltransferase isolated from Bacillus cereus.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29221985 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |
