BD0309453
(S)-2-Hydroxyethyl2-amino-3-methylbutanoate4-methylbenzenesulfonate , 95% , 86150-61-0
Synonym(s):
L -Valine 2-hydroxyethyl ester p-toluenesulfonate salt
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB535.20 | In Stock |
|
| 250mg | RMB802.40 | In Stock |
|
| 1g | RMB2004.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135°C |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | 1S/C7H15NO3.C7H8O3S/c1-5(2)6(8)7(10)11-4-3-9;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,9H,3-4,8H2,1-2H3;2-5H,1H3,(H,8,9,10)/t6-;/m0./s1 |
| InChIKey | KIQNQGPNCRYWKY-RGMNGODLSA-N |
| SMILES | CC(C)[C@H](N)C(=O)OCCO.Cc1ccc(cc1)S(O)(=O)=O |
Description and Uses
L-Valine 2-Hydroxyethyl Ester Tosylate is a L-Valacyclovir Hydrochloride (V085000) related compound F, which is the L-Valine ester prodrug of Acyclovir.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2922505000 |
| Storage Class | 13 - Non Combustible Solids |







