BD0330132
1-Phenylpyrazole-4-carboxaldehyde , 98% , 54605-72-0
Synonym(s):
1-Phenyl-1H-pyrazole-4-carbaldehyde
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB44.00 | In Stock |
|
| 250mg | RMB80.80 | In Stock |
|
| 1g | RMB232.00 | In Stock |
|
| 5g | RMB1089.60 | In Stock |
|
| 10g | RMB2106.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-88 °C |
| Boiling point: | 312.7±15.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | soluble in Toluene |
| form | Solid |
| pka | -2.57±0.10(Predicted) |
| color | Pale yellow |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C10H8N2O/c13-8-9-6-11-12(7-9)10-4-2-1-3-5-10/h1-8H |
| InChIKey | PHVRLPFVPVKYOI-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C=C(C=O)C=N1 |
| CAS DataBase Reference | 54605-72-0(CAS DataBase Reference) |
Description and Uses
1-Phenylpyrazole-4-carboxaldehyde is used to synthesize phenyl-pyrazolyl acrylic acid benzylidene carbohydrazide derivatives with antichagasic activities. It is also used to prepare ORL1 receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37-3/7 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
