BD0332432
5-Bromo-6-methylpyridin-2-ol , 96% , 54923-31-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB125.60 | In Stock |
|
| 10g | RMB199.20 | In Stock |
|
| 25g | RMB396.80 | In Stock |
|
| 100g | RMB1300.00 | In Stock |
|
| 500g | RMB3960.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-203 °C(lit.) |
| Boiling point: | 294.4±40.0 °C(Predicted) |
| Density | 1.5296 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Dimethylformamide |
| pka | 10.06±0.10(Predicted) |
| form | crystalline powder |
| color | Off-white/faint yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H6BrNO/c1-4-5(7)2-3-6(9)8-4/h2-3H,1H3,(H,8,9) |
| InChIKey | UJHCRBDEJPQFIA-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=C(Br)C=C1 |
Description and Uses
It is employed as a intermediate for pharmaceutical and organic synthesis.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36-39 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 29337900 |
