BD0336032
                    1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azapentadecan-15-oic acid , 95% , 139338-72-0
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB84.00 | In Stock | 
                                                 | 
                                        
| 250mg | RMB173.60 | In Stock | 
                                                 | 
                                        
| 1g | RMB536.00 | In Stock | 
                                                 | 
                                        
| 5g | RMB1948.80 | In Stock | 
                                                 | 
                                        
| 10g | RMB3598.40 | In Stock | 
                                                 | 
                                        
| 25g | RMB7764.80 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 46℃ | 
                                    
| Boiling point: | 658.9±50.0 °C(Predicted) | 
                                    
| Density | 1.248±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Soluble in DMSO | 
                                    
| form | Liquid | 
                                    
| pka | 3.39±0.10(Predicted) | 
                                    
| color | Colorless to light yellow | 
                                    
| InChI | InChI=1S/C23H27NO7/c25-22(26)16-30-14-13-29-12-11-28-10-9-24-23(27)31-15-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,21H,9-16H2,(H,24,27)(H,25,26) | 
                                    
| InChIKey | XNOJSAOJCBOZTA-UHFFFAOYSA-N | 
                                    
| SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCC(O)=O | 
                                    
Description and Uses
Fmoc-NH-PEG3-CH2COOH is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
Fmoc-9-amino-4,7-dioxanonanoic acid is an amino acid derivative and can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P271-P261-P280 | 
| HS Code | 2942000090 | 







