BD0340432
6-Aminopyridin-3-ol , 95% , 55717-46-9
CAS NO.：55717-46-9
Empirical Formula: C5H6N2O
Molecular Weight: 110.11
MDL number: MFCD03541056
EINECS: 692-865-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB256.00 | In Stock |
|
| 250mg | RMB309.60 | In Stock |
|
| 1g | RMB833.60 | In Stock |
|
| 5g | RMB2407.20 | In Stock |
|
| 10g | RMB4092.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-117 °C(Solv: methanol (67-56-1); benzene (71-43-2)) |
| Boiling point: | 447.4±30.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 10.47±0.10(Predicted) |
| form | Powder |
| Appearance | Gray to black Solid |
| InChI | InChI=1S/C5H6N2O/c6-5-2-1-4(8)3-7-5/h1-3,8H,(H2,6,7) |
| InChIKey | ZTWYBFHLUJUUDX-UHFFFAOYSA-N |
| SMILES | C1=NC(N)=CC=C1O |
| CAS DataBase Reference | 55717-46-9(CAS DataBase Reference) |
Description and Uses
2-Amino-5-hydroxypyridine is a substituted pyridine used as an efficient antioxidant in human low density lipoproteins.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2933399990 |
