BD0343232
1,1,1,3,5,7,7,7-Octamethyltetrasiloxane , 98% , 16066-09-4
CAS NO.：16066-09-4
Empirical Formula: C8H26O3Si4
Molecular Weight: 282.63
MDL number: MFCD00053664
EINECS: 240-209-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB54.40 | In Stock |
|
| 100g | RMB163.20 | In Stock |
|
| 500g | RMB536.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 92 °C |
| Density | 0.858 |
| refractive index | 1.3860 |
| Flash point: | 78°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| Specific Gravity | 0.858 |
| color | Colorless to Almost colorless |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | InChI=1S/C8H26O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h12-13H,1-8H3 |
| InChIKey | LBPUHXCOWXUVCE-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)O[SiH](C)O[SiH](C)O[Si](C)(C)C |
| EPA Substance Registry System | Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl- (16066-09-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1993 |
| TSCA | Yes |
| HS Code | 29319090 |
