PRODUCT Properties
| Melting point: | 9.5 °C |
| Boiling point: | 211°C 12mm |
| Density | 0,94 g/cm3 |
| refractive index | 1.4810 to 1.4830 |
| Flash point: | 171°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. light fatty waxy soapy |
| Odor Type | soapy |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-9-13-16-19(20)21-17-18-14-11-10-12-15-18/h10-12,14-15H,2-9,13,16-17H2,1H3 |
| InChIKey | QNRYOQRUGRVBRL-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)CCCCCCCCCCC |
| LogP | 7.093 (est) |
| EPA Substance Registry System | Dodecanoic acid, phenylmethyl ester (140-25-0) |
Description and Uses
benzyl laurate is an emollient ester that is easily emulsified and leaves the skin feeling silky. It is non-toxic, non-irritating, nonviscous, and non-oily. It also reduces the oiliness of mineral oil and solubilizes sunscreen actives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | JR3425000 |
| HS Code | 2915.90.2000 |
