BD0355745
5-Bromo-2-(2H-tetrazol-5-yl)pyridine , 95% , 380380-60-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB173.60 | In Stock |
|
| 1g | RMB451.20 | In Stock |
|
| 5g | RMB1125.60 | In Stock |
|
| 25g | RMB4138.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 396.5±52.0 °C(Predicted) |
| Density | 1.850±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.29±0.29(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C6H4BrN5/c7-4-1-2-5(8-3-4)6-9-11-12-10-6/h1-3H,(H,9,10,11,12) |
| InChIKey | LBDJSOHAVRCQPD-UHFFFAOYSA-N |
| SMILES | C1(C2=NNN=N2)=NC=C(Br)C=C1 |
Description and Uses
5-Bromo-2-(1H-tetrazol-5-yl)pyridine is a reagent in the synthesis and antibacterial activity of oxazolidinones containing pyridine substituted with heteroaromatic ring.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
