BD0358053
4,7-Difluoroisobenzofuran-1,3-dione , 98% , 652-40-4
Synonym(s):
4,7-Difluoro-1,3-isobenzofurandione;4,7-Difluoroisobenzofuran-1,3-dione
CAS NO.：652-40-4
Empirical Formula: C8H2F2O3
Molecular Weight: 184.1
MDL number: MFCD00134537
EINECS: 620-755-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB397.60 | In Stock |
|
| 250mg | RMB652.00 | In Stock |
|
| 1g | RMB1788.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-221 °C (lit.) |
| Boiling point: | 315.7±32.0 °C(Predicted) |
| Density | 1.658 |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Acetonitrile, DMSO |
| form | Solid |
| color | White |
| Sensitive | Moisture Sensitive |
| Stability: | moisture sensitive |
| InChI | InChI=1S/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H |
| InChIKey | AVLRPSLTCCWJKC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(F)=CC=C2F)C(=O)O1 |
| CAS DataBase Reference | 652-40-4(CAS DataBase Reference) |
Description and Uses
4,7-Difluoro-1,3-isobenzofurandione is used in the synthesis of phthalic compounds, phthalazines, and quinones with antimicrobial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29173990 |
