PRODUCT Properties
| Melting point: | 234 °C(Solv: ethanol, 60% (64-17-5)) |
| Boiling point: | 444.0±35.0 °C(Predicted) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 2.34±0.10(Predicted) |
| form | crystalline |
| color | light yellow |
| InChI | 1S/C12H14N2O2/c1-12(13,11(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,14H,6,13H2,1H3,(H,15,16) |
| InChIKey | ZTTWHZHBPDYSQB-UHFFFAOYSA-N |
| SMILES | CC(N)(Cc1c[nH]c2ccccc12)C(O)=O |
Description and Uses
α-methyl-DL-tryptophan is used as a blocker of ATBo, an amino acid transporter whose expression is upregulated in cancer. It is also a substrate or non-transported inhibitor of the amino acid transporter PAT2 (slc36a2).
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
