BD0374432
5-Bromo-1H-indazol-3-amine , 97% , 61272-71-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB69.60 | In Stock |
|
| 5g | RMB285.60 | In Stock |
|
| 10g | RMB490.40 | In Stock |
|
| 25g | RMB965.60 | In Stock |
|
| 100g | RMB2388.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-175 |
| Boiling point: | 431.3±25.0 °C(Predicted) |
| Density | 1.867±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 13+-.0.40(Predicted) |
| color | Clear colorless |
| InChI | InChI=1S/C7H6BrN3/c8-4-1-2-6-5(3-4)7(9)11-10-6/h1-3H,(H3,9,10,11) |
| InChIKey | OMPYFDJVSAMSMA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(N)=N1 |
| CAS DataBase Reference | 61272-71-7 |
Description and Uses
5-BROMO-1H-INDAZOL-3-AMINE can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 25-36/37/38-22 |
| Safety Statements | 45-36/37/39-26-22 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |




![5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/849068-61-7.gif)


![5-Bromo-1H-pyrrolo[3,2-b]pyridin-2(3H)-one](https://img.chemicalbook.com/CAS/20150408/GIF/887571-01-9.gif)