BD0374853
3,6-Dihydroxy-9H-xanthen-9-one , 95% , 1214-24-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB130.40 | In Stock |
|
| 250mg | RMB200.00 | In Stock |
|
| 1g | RMB506.40 | In Stock |
|
| 5g | RMB1806.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 350°C (rough estimate) |
| Boiling point: | 330°C (rough estimate) |
| Density | 1.3036 (rough estimate) |
| refractive index | 1.4977 (estimate) |
| storage temp. | 4°C, stored under nitrogen |
| form | Solid |
| pka | 7.18±0.20(Predicted) |
| color | White to yellow |
| InChI | InChI=1S/C13H8O4/c14-7-1-3-9-11(5-7)17-12-6-8(15)2-4-10(12)13(9)16/h1-6,14-15H |
| InChIKey | POARTHFLPKAZBQ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(O)C=C2)OC2=C1C=CC(O)=C2 |
Description and Uses
3,6-Dihydroxy-xanthen-9-one is used in preparation method of Heterocyclic compounds and application in the preparation of Lanreotide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
