PRODUCT Properties
| Boiling point: | 219℃ |
| Density | 1.177 |
| Flash point: | 87℃ |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | -5.43±0.50(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C6H7NO3/c1-2-9-6(8)5-3-4-10-7-5/h3-4H,2H2,1H3 |
| InChIKey | RKXWKTOBQOSONL-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OCC)=O)=N1 |
Description and Uses
Ethyl Isoxazol-3-carboxylate has been used as a reactant in the preparation of demethyl 2-amino-3-(3-carboxy-5-methyl-4-isoxazolyl)propionic acid (ACPA) which shows activity at metabotropic receptors and is a weak antagonist at the mGlu2 receptor subtype.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| HS Code | 2934999090 |







