BD0378553
1-Methyl-4-nitro-1H-imidazol-5-amine , 95% , 4531-54-8
Synonym(s):
1-Methyl-4-nitro-1H-imidazol-5-amine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB179.20 | In Stock |
|
| 250mg | RMB268.00 | In Stock |
|
| 1g | RMB672.00 | In Stock |
|
| 5g | RMB2584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >288°C (dec.) |
| Boiling point: | 435.0±25.0 °C(Predicted) |
| Density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly, Heated), Methanol (Very Slightly, Heated) |
| pka | 1.07±0.61(Predicted) |
| form | solid |
| color | Light Yellow to Light Green |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C4H6N4O2/c1-7-2-6-4(3(7)5)8(9)10/h2H,5H2,1H3 |
| InChIKey | GJVMTMXQJDQJSS-UHFFFAOYSA-N |
| SMILES | C1N(C)C(N)=C([N+]([O-])=O)N=1 |
Description and Uses
5-Amino-1-methyl-4-nitroimidazole is a moiety of Azathioprine (A803350); an immunosuppressive antimetabolite that is also active as a disease modifying antirheumatic drug (DMARD).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933997500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
