BD0381845
4,4'-(Perfluoropropane-2,2-diyl)bis(methylbenzene) , 98% , 1095-77-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB62.40 | In Stock |
|
| 25g | RMB220.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82 °C |
| Boiling point: | 117°C/2mm |
| Density | 1.1865 (rough estimate) |
| refractive index | 1.4250 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C17H14F6/c1-11-3-7-13(8-4-11)15(16(18,19)20,17(21,22)23)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | OWEIAGSMFHSSES-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 1095-77-8(CAS DataBase Reference) |
Description and Uses
2,2-Bis(4-methylphenyl)hexafluoropropane is used as an intermediate in the synthesis of fluorinated bifunctional monomers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P321-P322-P330-P332+P313-P337+P313-P362-P363-P403+P233-P403+P235-P405-P501 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
