BD0386645
6,7-Dihydro-5H-pyrrolo[3,4-b]pyridinedihydrochloride , 95% , 147740-02-1
CAS NO.:147740-02-1
Empirical Formula: C7H9ClN2
Molecular Weight: 156.613
MDL number: MFCD09607967
EINECS: 828-770-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB140.80 | In Stock |
|
| 1g | RMB337.60 | In Stock |
|
| 5g | RMB1228.80 | In Stock |
|
| 10g | RMB2371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C7H8N2.ClH/c1-2-6-4-8-5-7(6)9-3-1;/h1-3,8H,4-5H2;1H |
| InChIKey | OLSODEICZBRTGO-UHFFFAOYSA-N |
| SMILES | C12C=CC=NC=1CNC2.Cl |
Description and Uses
6,7-Dihydro-5h-pyrrolo[3,4-b]pyridine, HCl
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H303-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P312-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2933998090 |

![6,7-Dihydro-5H-pyrrolo[3,4-b]pyridinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/147740-02-1.gif)

![6,7-Dihydro-5H-pyrrolo[3,4-b]pyridine](https://img.chemicalbook.com/CAS/GIF/147739-88-6.gif)