BD0392432
1-(2-Deoxy-2-fluoro-b-D-arabinofuranosyl)uracil , 95% , 69123-94-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB152.00 | In Stock |
|
| 250mg | RMB256.80 | In Stock |
|
| 1g | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Methanol: Soluble |
| pka | 9.39±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1/C9H11FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6+,7-,8-/s3 |
| InChIKey | UIYWFOZZIZEEKJ-QOUWCGOQNA-N |
| SMILES | [C@@H]1([C@@H](F)[C@H](O)[C@@H](CO)O1)N1C=CC(=O)NC1=O |&1:0,1,3,5,r| |
| CAS DataBase Reference | 69123-94-0 |
Description and Uses
1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1].
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H335-H340 |
| Precautionary statements | P260-P280-P301+P312 |
| HS Code | 2934999090 |
