BD0392832
Quinoxaline-5-carboxylic acid , 97% , 6924-66-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB148.00 | In Stock |
|
| 1g | RMB346.40 | In Stock |
|
| 5g | RMB1088.00 | In Stock |
|
| 10g | RMB1781.60 | In Stock |
|
| 25g | RMB4100.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 394.8±22.0 °C(Predicted) |
| Density | 1.421±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.16±0.10(Predicted) |
| form | Powder |
| color | Brown |
| InChI | InChI=1S/C9H6N2O2/c12-9(13)6-2-1-3-7-8(6)11-5-4-10-7/h1-5H,(H,12,13) |
| InChIKey | QLZNISOPACYKOR-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(C(O)=O)C=CC=2)N=CC=1 |
Description and Uses
Quinoxaline-5-carboxylic Acid is a useful research chemical compound used in the preparation of aminooxazole carbonitriles and other naphthyl-substituted heterocyclic amines as selective inhibitors of 12/15-lipoxygenase for anti-stroke therapy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P312 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 29339980 |
