BD0410532
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine , 97% , 827614-64-2
Synonym(s):
(2-Aminopyridin-5-yl)boronic acid pinacol ester;2-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-Pyridinamine;6-Aminopyridine-3-boronic acid pinacol ester
CAS NO.:827614-64-2
Empirical Formula: C11H17BN2O2
Molecular Weight: 220.08
MDL number: MFCD05663837
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB34.40 | In Stock |
|
| 1g | RMB94.40 | In Stock |
|
| 5g | RMB381.60 | In Stock |
|
| 10g | RMB624.00 | In Stock |
|
| 25g | RMB1254.40 | In Stock |
|
| 100g | RMB3964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-135 °C(lit.) |
| Boiling point: | 146°C/0.3mm |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | 7.03±0.26(Predicted) |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C11H17BN2O2/c1-10(2)11(3,4)16-12(15-10)8-5-6-9(13)14-7-8/h5-7H,1-4H3,(H2,13,14) |
| InChIKey | YFTAUNOLAHRUIE-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| CAS DataBase Reference | 827614-64-2(CAS DataBase Reference) |
Description and Uses
It is an important raw material and intermediate. Substrate employed in a microwave-assisted, four-component coupling process leading to amino substituted imidazopyridines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







