BD0415245
N6-Cyclopropyl-9H-purine-2,6-diamine , 95% , 120503-69-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB206.40 | In Stock |
|
| 250mg | RMB308.80 | In Stock |
|
| 1g | RMB779.20 | In Stock |
|
| 5g | RMB2392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-174oC |
| Density | 1.97 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C8H10N6/c9-8-13-6-5(10-3-11-6)7(14-8)12-4-1-2-4/h3-4H,1-2H2,(H4,9,10,11,12,13,14) |
| InChIKey | IYWUSKBMXQERLH-UHFFFAOYSA-N |
| SMILES | [nH]1c2nc(nc(c2nc1)NC3CC3)N |
Description and Uses
N6-Cyclopropyl-9H-purine-2,6-diamine is an impurity of Abacavir Sulfate (A105000), a nucleoside reverse transcriptase inhibitor (1,2,3).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| WGK Germany | WGK 3 |
| Storage Class | 13 - Non Combustible Solids |
