![7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-ol](https://img.chemicalbook.com/CAS/20200611/GIF/1985607-83-7.gif)
BD0417553
7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-ol , 95% , 1985607-83-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB128.80 | In Stock |
|
| 25g | RMB552.80 | In Stock |
|
| 100g | RMB2053.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 379.5±42.0 °C(Predicted) |
| Density | 1.400±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, sealed storage, away from moisture and light |
| pka | 12.57±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| optical activity | 16.5364°(C=1.0046g/100ml CHCL3) |
| InChI | InChI=1S/C14H10F2OS/c15-11-6-5-8-10(13(11)16)7-18-12-4-2-1-3-9(12)14(8)17/h1-6,14,17H,7H2 |
| InChIKey | OBEXFUFBCNVOKB-UHFFFAOYSA-N |
| SMILES | S1CC2=C(F)C(F)=CC=C2C(O)C2=CC=CC=C12 |
Description and Uses
7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-ol is an impurity of Baloxavir Marboxil (B116325) which is an inhibitor of the cap-dependent endonuclease of influenza A and B viruses.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
