PRODUCT Properties
| Melting point: | 113-118 °C |
| Boiling point: | 162-165 °C |
| Density | 0.53 |
| refractive index | 1.4628 (estimate) |
| Flash point: | 58 °C |
| storage temp. | 2-8°C |
| pka | 9.66(at 25℃) |
| InChI | InChI=1S/C6H14N2/c1-5-3-8-6(2)4-7-5/h5-8H,3-4H2,1-2H3 |
| InChIKey | NSMWYRLQHIXVAP-UHFFFAOYSA-N |
| SMILES | N1CC(C)NCC1C |
| CAS DataBase Reference | 106-55-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Piperazine, 2,5-dimethyl-(106-55-8) |
| EPA Substance Registry System | Piperazine, 2,5-dimethyl- (106-55-8) |
Description and Uses
Trans-2,5-dimethylpiperazine is primarily as a monomer for synthesizing a specific polyamide polymer, which is then used as a material for reverse osmosis membranes.[1]
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H228-H303-H311-H315-H319 |
| Precautionary statements | P210-P240-P241-P264-P280-P302+P352+P312+P361+P364-P305+P351+P338+P337+P313-P312-P405-P501 |
| Hazard Codes | C-F |
| Risk Statements | 34-21-11 |
| Safety Statements | 45-36/37/39-26-16 |
| TSCA | TSCA listed |
| Toxicity | rabbit,LD50,skin,800uL/kg (0.8mL/kg),AMA Archives of Industrial Hygiene and Occupational Medicine. Vol. 4, Pg. 119, 1951. |







