BD0431932
6-Amino-4-((3-chloro-4-(pyridin-2-ylmethoxy)phenyl)amino)-7-ethoxyquinoline-3-carbonitrile , 95% , 848139-78-6
CAS NO.：848139-78-6
Empirical Formula: C24H20ClN5O2
Molecular Weight: 445.9
MDL number: MFCD12032114
EINECS: 810-025-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB44.00 | In Stock |
|
| 250mg | RMB67.20 | In Stock |
|
| 1g | RMB167.20 | In Stock |
|
| 5g | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-238oC (dec.) |
| Boiling point: | 649.8±55.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Dichloromethane (Slightly), DMSO (Slightly) |
| pka | 5.09±0.50(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C24H20ClN5O2/c1-2-31-23-11-21-18(10-20(23)27)24(15(12-26)13-29-21)30-16-6-7-22(19(25)9-16)32-14-17-5-3-4-8-28-17/h3-11,13H,2,14,27H2,1H3,(H,29,30) |
| InChIKey | WRGKROVGVSWJMI-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(N)=C(OCC)C=2)C(NC2=CC=C(OCC3=NC=CC=C3)C(Cl)=C2)=C(C#N)C=1 |
Description and Uses
6-amino-4-(3-chloro-4-(pyridin-2-ylmethoxy)phenylamino)-7-ethoxyquinoline-3-carbonitrile is a quinoline derivative and can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
